CAS 2143-87-5 appears in our catalog under these names: 4-Dimethylamino-4'-nitrobiphenyl, 98%, N,N-Dimethyl-4'-nitro-(1,1'-biphenyl)-4-amine, 95+%, N,N–Dimethyl–4′–nitro(1,1′–biphenyl)–4–amine, 4-Dimethylamino-4'-nitrobiphenyl, >98.0%(HPLC), N,N-Dimethyl-4'-nitro-[1,1'-biphenyl]-4-amine, ≥98%, ≥98%. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Chemat. Available pack sizes: 5g, 250mg, 1g, 200mg.
N,N-dimethyl-4-(4-nitrophenyl)aniline (CAS 2143-87-5) is a chemical compound with the molecular formula C14H14N2O2 and a molecular weight of 242.27 g/mol. IUPAC name: N,N-dimethyl-4-(4-nitrophenyl)aniline. InChIKey: PLGALHOPBAVGHQ-UHFFFAOYSA-N.
| Molecular formula | C14H14N2O2 |
|---|---|
| Molecular weight | 242.27 g/mol |
| IUPAC name | N,N-dimethyl-4-(4-nitrophenyl)aniline |
| InChIKey | PLGALHOPBAVGHQ-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)