cas: 854952-58-2 — see every product listed under this CAS number, including other names
(9-Phenyl-9H-carbazol-3-yl)boronic acid 97% (CAS 854952-58-2) is a chemical reagent available from Chemat. Available pack sizes: 1000g, 250mg, 1g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A205204-1000g |
| cas | 854952-58-2 |
| size | 1000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1000g | 2628.75 Pln | |
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 25g | 186.81 Pln | |
| Ambeed | 100g | 487.19 Pln | |
| Ambeed | 500g | 1666.44 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A205204 |
(9-phenylcarbazol-3-yl)boronic acid (CAS 854952-58-2) is a chemical compound with the molecular formula C18H14BNO2 and a molecular weight of 287.1 g/mol. IUPAC name: (9-phenylcarbazol-3-yl)boronic acid. InChIKey: JWJQEUDGBZMPAX-UHFFFAOYSA-N.
| Molecular formula | C18H14BNO2 |
|---|---|
| Molecular weight | 287.1 g/mol |
| IUPAC name | (9-phenylcarbazol-3-yl)boronic acid |
| InChIKey | JWJQEUDGBZMPAX-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)N(C3=CC=CC=C32)C4=CC=CC=C4)(O)O |
Computed by PubChem (NCBI)