cas: 854952-58-2 — see every product listed under this CAS number, including other names
(9-Phenyl-9H-carbazol-3-yl)boronic acid, 97%, 97% (CAS 854952-58-2) is a chemical reagent available from Chemat. Available pack sizes: 500g, 1kg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114NLQ-500g |
| cas | 854952-58-2 |
| size | 500g |
| availability | 3000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 500g | 1276.80 Pln | |
| Chemat | 1kg | 2008.40 Pln | |
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 83.60 Pln | |
| Chemat | 10g | 88.40 Pln | |
| Chemat | 25g | 126.80 Pln | |
| Chemat | 100g | 314.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(9-phenylcarbazol-3-yl)boronic acid (CAS 854952-58-2) is a chemical compound with the molecular formula C18H14BNO2 and a molecular weight of 287.1 g/mol. IUPAC name: (9-phenylcarbazol-3-yl)boronic acid. InChIKey: JWJQEUDGBZMPAX-UHFFFAOYSA-N.
| Molecular formula | C18H14BNO2 |
|---|---|
| Molecular weight | 287.1 g/mol |
| IUPAC name | (9-phenylcarbazol-3-yl)boronic acid |
| InChIKey | JWJQEUDGBZMPAX-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)N(C3=CC=CC=C32)C4=CC=CC=C4)(O)O |
Computed by PubChem (NCBI)