(9H-Fluoren-9-yl)methyl (5-aminopentyl)carbamate hydrochloride, 99%
cas: 177333-17-4 — see every product listed under this CAS number, including other names
(9H-Fluoren-9-yl)methyl (5-aminopentyl)carbamate hydrochloride, 99% (CAS 177333-17-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: BLDpharm, Chemat, Fluorochem.
| brand | BLDpharm |
|---|---|
| catalog number | BD00770667-100mg |
| cas | 177333-17-4 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| BLDpharm | 100mg | 186.63 Pln | |
| BLDpharm | 250mg | 297.70 Pln | |
| BLDpharm | 1g | 853.06 Pln | |
| BLDpharm | 5g | 2885.68 Pln | |
| BLDpharm | 10g | 4474.00 Pln | |
| Chemat | 100mg | 141.20 Pln | |
| Chemat | 250mg | 222.80 Pln | |
| Chemat | 1g | 602.00 Pln | |
| Chemat | 5g | 2013.20 Pln | |
| Fluorochem | 250mg | 388.42 Pln | |
| Fluorochem | 1g | 1106.92 Pln | |
| Fluorochem | 5g | 3725.79 Pln |
properties
| purity | 99% |
|---|---|
| delivery time | 3-4 weeks |
9H-fluoren-9-ylmethyl N-(5-aminopentyl)carbamate;hydrochloride (CAS 177333-17-4) is a chemical compound with the molecular formula C20H25ClN2O2 and a molecular weight of 360.9 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl N-(5-aminopentyl)carbamate;hydrochloride. InChIKey: MYVDRDMFYHOZBJ-UHFFFAOYSA-N.
| Molecular formula | C20H25ClN2O2 |
|---|---|
| Molecular weight | 360.9 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethyl N-(5-aminopentyl)carbamate;hydrochloride |
| InChIKey | MYVDRDMFYHOZBJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCCCCCN.Cl |
Computed by PubChem (NCBI)
Synonyms:
(9H-Fluoren-9-yl)methyl (5-aminopentyl)carbamate hydrochloride, N-Fmoc-1,5-diaminopentane HCl, N-1-Fmoc-1,5-diaminopentane HCl, fmoc-1,5-diaminopentane hydrochloride, 9H-fluoren-9-ylmethyl N-(5-aminopentyl)carbamate;hydrochloride, N-1-Fmoc-1,5-diaminopentane . HCl, Fmoc-DAPe.HCl, Fmoc-dape hydrochloride, orb3176890, Fmoc-NH-(CH2)5-NH2.HCl