cas: 1603815-91-3 — see every product listed under this CAS number, including other names
(E)-1-(2-Bromo-4-methylphenyl)-3,3-diethyltriaz-1-ene, 95-<97% (CAS 1603815-91-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g. Offered by: Hoffman Fine Chemicals.
| brand | Hoffman Fine Chemicals |
|---|---|
| catalog number | HFC6818-95-97-5g |
| cas | 1603815-91-3 |
| size | 5g |
| availability | 3-4 tygodnie|3-4 weeks |
| brand | size | price | |
|---|---|---|---|
| Hoffman Fine Chemicals | 5g | 11020.02 Pln | |
| Hoffman Fine Chemicals | 10g | 17444.68 Pln | |
| Hoffman Fine Chemicals | 25g | 34587.74 Pln |
| purity | 95-<97% |
|---|---|
| category | Chemicals |
| delivery time | 3-4 weeks |
N-[(2-bromo-4-methylphenyl)diazenyl]-N-ethylethanamine (CAS 1603815-91-3) is a chemical compound with the molecular formula C11H16BrN3 and a molecular weight of 270.17 g/mol. IUPAC name: N-[(2-bromo-4-methylphenyl)diazenyl]-N-ethylethanamine. InChIKey: YQHVIYQZCJNNPR-UHFFFAOYSA-N.
| Molecular formula | C11H16BrN3 |
|---|---|
| Molecular weight | 270.17 g/mol |
| IUPAC name | N-[(2-bromo-4-methylphenyl)diazenyl]-N-ethylethanamine |
| InChIKey | YQHVIYQZCJNNPR-UHFFFAOYSA-N |
| SMILES | CCN(CC)N=NC1=C(C=C(C=C1)C)Br |
Computed by PubChem (NCBI)