CAS 1454301-28-0 is the registry number for 1-(5-Bromo-6-methylpyridin-2-yl)-4-methylpiperazine, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1-(5-bromo-6-methyl-2-pyridinyl)-4-methylpiperazine (CAS 1454301-28-0) is a chemical compound with the molecular formula C11H16BrN3 and a molecular weight of 270.17 g/mol. IUPAC name: 1-(5-bromo-6-methyl-2-pyridinyl)-4-methylpiperazine. InChIKey: WHSLCLOMSJQONW-UHFFFAOYSA-N.
| Molecular formula | C11H16BrN3 |
|---|---|
| Molecular weight | 270.17 g/mol |
| IUPAC name | 1-(5-bromo-6-methyl-2-pyridinyl)-4-methylpiperazine |
| InChIKey | WHSLCLOMSJQONW-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=N1)N2CCN(CC2)C)Br |
Computed by PubChem (NCBI)