CAS 885461-06-3 appears in our catalog under these names: 5-Bromo-2-(4-methylpiperazin-1-yl)aniline, 95%, 5-Bromo-2-(4-methyl-1-piperazinyl)aniline. Offered by: Combi-blocks, Biosynth. Available pack sizes: 100mg, 500mg, 1g.
5-bromo-2-(4-methylpiperazin-1-yl)aniline (CAS 885461-06-3) is a chemical compound with the molecular formula C11H16BrN3 and a molecular weight of 270.17 g/mol. IUPAC name: 5-bromo-2-(4-methylpiperazin-1-yl)aniline. InChIKey: QRSKVMNMLVQJPL-UHFFFAOYSA-N.
| Molecular formula | C11H16BrN3 |
|---|---|
| Molecular weight | 270.17 g/mol |
| IUPAC name | 5-bromo-2-(4-methylpiperazin-1-yl)aniline |
| InChIKey | QRSKVMNMLVQJPL-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=C(C=C(C=C2)Br)N |
Computed by PubChem (NCBI)