CAS 166818-86-6 appears in our catalog under these names: 2–Bromo–4–(4–methylpiperazin–1–yl)aniline, 2-Bromo-4-(4-methylpiperazin-1-yl)aniline, 97%, 97%, 2-Bromo-4-(4-methyl-piperazin-1-yl)-phenylamine, 95%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-bromo-4-(4-methylpiperazin-1-yl)aniline (CAS 166818-86-6) is a chemical compound with the molecular formula C11H16BrN3 and a molecular weight of 270.17 g/mol. IUPAC name: 2-bromo-4-(4-methylpiperazin-1-yl)aniline. InChIKey: LFYUFSZCTMVRAQ-UHFFFAOYSA-N.
| Molecular formula | C11H16BrN3 |
|---|---|
| Molecular weight | 270.17 g/mol |
| IUPAC name | 2-bromo-4-(4-methylpiperazin-1-yl)aniline |
| InChIKey | LFYUFSZCTMVRAQ-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=CC(=C(C=C2)N)Br |
Computed by PubChem (NCBI)