cas: 876376-75-9 — see every product listed under this CAS number, including other names
(E)-1-(3-Chlorophenyl)-3-(dimethylamino)prop-2-en-1-one 98% (CAS 876376-75-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A191200-1g |
| cas | 876376-75-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 303.62 Pln | |
| Ambeed | 5g | 748.62 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A191200 |
(E)-1-(3-chlorophenyl)-3-(dimethylamino)prop-2-en-1-one (CAS 876376-75-9) is a chemical compound with the molecular formula C11H12ClNO and a molecular weight of 209.67 g/mol. IUPAC name: (E)-1-(3-chlorophenyl)-3-(dimethylamino)prop-2-en-1-one. InChIKey: LDBZHHVGVAIVBT-VOTSOKGWSA-N.
| Molecular formula | C11H12ClNO |
|---|---|
| Molecular weight | 209.67 g/mol |
| IUPAC name | (E)-1-(3-chlorophenyl)-3-(dimethylamino)prop-2-en-1-one |
| InChIKey | LDBZHHVGVAIVBT-VOTSOKGWSA-N |
| SMILES | CN(C)/C=C/C(=O)C1=CC(=CC=C1)Cl |
Computed by PubChem (NCBI)