cas: 18315-84-9 — see every product listed under this CAS number, including other names
(E)-1-Phenyl-2-nitro-1-propene, 98.0%, 98.0% (CAS 18315-84-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11AYVU-5g |
| cas | 18315-84-9 |
| size | 5g |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 304.40 Pln | |
| Chemat | 25g | 990.80 Pln |
| purity | 98.0% |
|---|---|
| delivery time | 3 weeks |
[(E)-2-nitroprop-1-enyl]benzene (CAS 18315-84-9) is a chemical compound with the molecular formula C9H9NO2 and a molecular weight of 163.17 g/mol. IUPAC name: [(E)-2-nitroprop-1-enyl]benzene. InChIKey: WGSVFWFSJDAYBM-BQYQJAHWSA-N.
| Molecular formula | C9H9NO2 |
|---|---|
| Molecular weight | 163.17 g/mol |
| IUPAC name | [(E)-2-nitroprop-1-enyl]benzene |
| InChIKey | WGSVFWFSJDAYBM-BQYQJAHWSA-N |
| SMILES | C/C(=C\C1=CC=CC=C1)/[N+](=O)[O-] |
Computed by PubChem (NCBI)