CAS 1616705-60-2 appears in our catalog under these names: (1S,3R)-3-(tert-Butoxycarbonyl)-2,2-dimethylcyclobutane-1-carboxylic acid, 97%, (1S,3R)–3–(tert–butoxycarbonyl)–2,2–dimethylcyclobutanecarboxylic acid. Offered by: AmBeed, GLPBio. Available pack sizes: 5g, 1g, 100mg, 250mg.
[(E)-2-nitroprop-1-enyl]benzene (CAS 705-60-2) is a chemical compound with the molecular formula C9H9NO2 and a molecular weight of 163.17 g/mol. IUPAC name: [(E)-2-nitroprop-1-enyl]benzene. InChIKey: WGSVFWFSJDAYBM-BQYQJAHWSA-N.
| Molecular formula | C9H9NO2 |
|---|---|
| Molecular weight | 163.17 g/mol |
| IUPAC name | [(E)-2-nitroprop-1-enyl]benzene |
| InChIKey | WGSVFWFSJDAYBM-BQYQJAHWSA-N |
| SMILES | C/C(=C\C1=CC=CC=C1)/[N+](=O)[O-] |
Computed by PubChem (NCBI)