cas: 1201905-61-4 — see every product listed under this CAS number, including other names
(E)-2-(2-Ethoxyvinyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 96% (CAS 1201905-61-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A204130-1g |
| cas | 1201905-61-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 203.50 Pln | |
| Ambeed | 10g | 281.38 Pln | |
| Ambeed | 25g | 537.25 Pln | |
| Ambeed | 100g | 1722.06 Pln | |
| Ambeed | 500g | 7701.75 Pln | |
| Ambeed | 1000g | 13926.19 Pln |
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A204130 |
2-[(E)-2-ethoxyethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1201905-61-4) is a chemical compound with the molecular formula C10H19BO3 and a molecular weight of 198.07 g/mol. IUPAC name: 2-[(E)-2-ethoxyethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: MRAYNLYCQPAZJN-BQYQJAHWSA-N.
| Molecular formula | C10H19BO3 |
|---|---|
| Molecular weight | 198.07 g/mol |
| IUPAC name | 2-[(E)-2-ethoxyethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | MRAYNLYCQPAZJN-BQYQJAHWSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)/C=C/OCC |
Computed by PubChem (NCBI)