cas: 1201905-61-4 — see every product listed under this CAS number, including other names
(E)-(2-Ethoxyvinyl)boronic acid pinacol ester, 95% (CAS 1201905-61-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F469035-250MG |
| cas | 1201905-61-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 96.86 Pln | |
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 190.58 Pln | |
| Fluorochem | 10g | 263.47 Pln | |
| Fluorochem | 25g | 529.00 Pln | |
| Fluorochem | 100g | 1507.82 Pln | |
| Fluorochem | 500g | 6610.19 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
2-[(E)-2-ethoxyethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1201905-61-4) is a chemical compound with the molecular formula C10H19BO3 and a molecular weight of 198.07 g/mol. IUPAC name: 2-[(E)-2-ethoxyethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: MRAYNLYCQPAZJN-BQYQJAHWSA-N.
| Molecular formula | C10H19BO3 |
|---|---|
| Molecular weight | 198.07 g/mol |
| IUPAC name | 2-[(E)-2-ethoxyethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | MRAYNLYCQPAZJN-BQYQJAHWSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)/C=C/OCC |
Computed by PubChem (NCBI)