cas: 1073354-86-5 — see every product listed under this CAS number, including other names
(E)-2-(3,5-Dimethoxystyryl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%, 98% (CAS 1073354-86-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114C19-100mg |
| cas | 1073354-86-5 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 122.00 Pln | |
| Chemat | 1g | 256.40 Pln | |
| Chemat | 5g | 1034.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1073354-86-5) is a chemical compound with the molecular formula C16H23BO4 and a molecular weight of 290.2 g/mol. IUPAC name: 2-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: NTOQJUAKAYKAPE-BQYQJAHWSA-N.
| Molecular formula | C16H23BO4 |
|---|---|
| Molecular weight | 290.2 g/mol |
| IUPAC name | 2-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | NTOQJUAKAYKAPE-BQYQJAHWSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)/C=C/C2=CC(=CC(=C2)OC)OC |
Computed by PubChem (NCBI)