CAS 2304633-93-8 appears in our catalog under these names: 2-(Acetoxymethyl)-6-methylphenylboronic acid pinacol ester, 95%, 2-(Acetoxymethyl)-6-methylphenylboronic Acid Pinacol Ester, ≥95%, ≥95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 5g, 250mg, 1g.
[3-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl acetate (CAS 2304633-93-8) is a chemical compound with the molecular formula C16H23BO4 and a molecular weight of 290.2 g/mol. IUPAC name: [3-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl acetate. InChIKey: FTPUNPSIOIOENE-UHFFFAOYSA-N.
| Molecular formula | C16H23BO4 |
|---|---|
| Molecular weight | 290.2 g/mol |
| IUPAC name | [3-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl acetate |
| InChIKey | FTPUNPSIOIOENE-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC=C2COC(=O)C)C |
Computed by PubChem (NCBI)