CAS 2304635-81-0 is the registry number for (3-(Acetoxymethyl)-4-methylphenyl)boronic acid pinacol ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
[2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl acetate (CAS 2304635-81-0) is a chemical compound with the molecular formula C16H23BO4 and a molecular weight of 290.2 g/mol. IUPAC name: [2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl acetate. InChIKey: JXVODTGFIKQFBN-UHFFFAOYSA-N.
| Molecular formula | C16H23BO4 |
|---|---|
| Molecular weight | 290.2 g/mol |
| IUPAC name | [2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl acetate |
| InChIKey | JXVODTGFIKQFBN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)C)COC(=O)C |
Computed by PubChem (NCBI)