CAS 2096333-27-4 appears in our catalog under these names: 3,5-Dimethyl-4-methoxycarbonylphenylboronic acid, pinacol ester, 3,5-Dimethyl-4-methoxycarbonylphenylboronic acid, pinacol ester, 98%, 3,5-Dimethyl-4-methoxycarbonylphenylboronic acid, pinacol ester, 97%, 97%, Methyl 2,6-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate, 97%. Offered by: Biosynth, Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 0,5g, 5g, 250mg, 1g, 10g.
Methyl 2,6-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (CAS 2096333-27-4) is a chemical compound with the molecular formula C16H23BO4 and a molecular weight of 290.2 g/mol. IUPAC name: methyl 2,6-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate. InChIKey: VDELJAWMMVSPIE-UHFFFAOYSA-N.
| Molecular formula | C16H23BO4 |
|---|---|
| Molecular weight | 290.2 g/mol |
| IUPAC name | methyl 2,6-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| InChIKey | VDELJAWMMVSPIE-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C(=C2)C)C(=O)OC)C |
Computed by PubChem (NCBI)