cas: 1258875-12-5 — see every product listed under this CAS number, including other names
(E)-2-(3-Bromo-5-nitropyridin-4-yl)-N,N-dimethylethen-1-amine, 98% (CAS 1258875-12-5) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1631926-10g |
| cas | 1258875-12-5 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 9548.56 Pln | |
| AmBeed | 25g | 18688.60 Pln | |
| AmBeed | 5g | 5655.58 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
(E)-2-(3-bromo-5-nitro-4-pyridinyl)-N,N-dimethylethenamine (CAS 1258875-12-5) is a chemical compound with the molecular formula C9H10BrN3O2 and a molecular weight of 272.10 g/mol. IUPAC name: (E)-2-(3-bromo-5-nitro-4-pyridinyl)-N,N-dimethylethenamine. InChIKey: WWOCIGHHNAXTRI-ONEGZZNKSA-N.
| Molecular formula | C9H10BrN3O2 |
|---|---|
| Molecular weight | 272.10 g/mol |
| IUPAC name | (E)-2-(3-bromo-5-nitro-4-pyridinyl)-N,N-dimethylethenamine |
| InChIKey | WWOCIGHHNAXTRI-ONEGZZNKSA-N |
| SMILES | CN(C)/C=C/C1=C(C=NC=C1[N+](=O)[O-])Br |
Computed by PubChem (NCBI)