Products 1229457-88-8
CAS 1229457-88-8 is the registry number for (E)-2-(5-Bromo-3-nitropyridin-2-yl)-N,N-dimethylethen-1-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(E)-2-(5-bromo-3-nitro-2-pyridinyl)-N,N-dimethylethenamine (CAS 1229457-88-8) is a chemical compound with the molecular formula C9H10BrN3O2 and a molecular weight of 272.10 g/mol. IUPAC name: (E)-2-(5-bromo-3-nitro-2-pyridinyl)-N,N-dimethylethenamine. InChIKey: DGQGEEKJHSDVMR-ONEGZZNKSA-N.
| Molecular formula | C9H10BrN3O2 |
|---|---|
| Molecular weight | 272.10 g/mol |
| IUPAC name | (E)-2-(5-bromo-3-nitro-2-pyridinyl)-N,N-dimethylethenamine |
| InChIKey | DGQGEEKJHSDVMR-ONEGZZNKSA-N |
| SMILES | CN(C)/C=C/C1=C(C=C(C=N1)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)