CAS 1258875-12-5 appears in our catalog under these names: 2-(3-Bromo-5-nitro-4-pyridinyl)-n,n-dimethylethenamine, 95%, (E)-2-(3-Bromo-5-nitropyridin-4-yl)-N,N-dimethylethen-1-amine, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 25g, 10g, 1g, 250mg.
(E)-2-(3-bromo-5-nitro-4-pyridinyl)-N,N-dimethylethenamine (CAS 1258875-12-5) is a chemical compound with the molecular formula C9H10BrN3O2 and a molecular weight of 272.10 g/mol. IUPAC name: (E)-2-(3-bromo-5-nitro-4-pyridinyl)-N,N-dimethylethenamine. InChIKey: WWOCIGHHNAXTRI-ONEGZZNKSA-N.
| Molecular formula | C9H10BrN3O2 |
|---|---|
| Molecular weight | 272.10 g/mol |
| IUPAC name | (E)-2-(3-bromo-5-nitro-4-pyridinyl)-N,N-dimethylethenamine |
| InChIKey | WWOCIGHHNAXTRI-ONEGZZNKSA-N |
| SMILES | CN(C)/C=C/C1=C(C=NC=C1[N+](=O)[O-])Br |
Computed by PubChem (NCBI)