Products 1307510-00-4
CAS 1307510-00-4 is the registry number for N-(2-Amino-2-oxoethyl)-5-bromo-N-methylnicotinamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(2-amino-2-oxoethyl)-5-bromo-N-methylpyridine-3-carboxamide (CAS 1307510-00-4) is a chemical compound with the molecular formula C9H10BrN3O2 and a molecular weight of 272.10 g/mol. IUPAC name: N-(2-amino-2-oxoethyl)-5-bromo-N-methylpyridine-3-carboxamide. InChIKey: FCYMRDRDKPUOGP-UHFFFAOYSA-N.
| Molecular formula | C9H10BrN3O2 |
|---|---|
| Molecular weight | 272.10 g/mol |
| IUPAC name | N-(2-amino-2-oxoethyl)-5-bromo-N-methylpyridine-3-carboxamide |
| InChIKey | FCYMRDRDKPUOGP-UHFFFAOYSA-N |
| SMILES | CN(CC(=O)N)C(=O)C1=CC(=CN=C1)Br |
Computed by PubChem (NCBI)