cas: 1190217-35-6 — see every product listed under this CAS number, including other names
(E)-2-(7-Fluoro-1-isobutyl-2-oxoindolin-3-ylidene)acetic acid, 99%, 99% (CAS 1190217-35-6) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12E122-1mg |
| cas | 1190217-35-6 |
| size | 1mg |
| availability | 0.5g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1mg | 174.80 Pln | |
| Chemat | 5mg | 338.00 Pln | |
| Chemat | 10mg | 390.80 Pln | |
| Chemat | 25mg | 453.20 Pln | |
| Chemat | 50mg | 731.60 Pln | |
| Chemat | 100mg | 1086.80 Pln | |
| Chemat | 250mg | 1998.80 Pln |
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
(2E)-2-[7-fluoro-1-(2-methylpropyl)-2-oxoindol-3-ylidene]acetic acid (CAS 1190217-35-6) is a chemical compound with the molecular formula C14H14FNO3 and a molecular weight of 263.26 g/mol. IUPAC name: (2E)-2-[7-fluoro-1-(2-methylpropyl)-2-oxoindol-3-ylidene]acetic acid. InChIKey: RCVZUIGCNAAMIC-UXBLZVDNSA-N.
| Molecular formula | C14H14FNO3 |
|---|---|
| Molecular weight | 263.26 g/mol |
| IUPAC name | (2E)-2-[7-fluoro-1-(2-methylpropyl)-2-oxoindol-3-ylidene]acetic acid |
| InChIKey | RCVZUIGCNAAMIC-UXBLZVDNSA-N |
| SMILES | CC(C)CN1C2=C(C=CC=C2F)/C(=C\C(=O)O)/C1=O |
Computed by PubChem (NCBI)