CAS 1190217-35-6 appears in our catalog under these names: ASP 7663, ASP7663/ 98.11% (existing batch purity), ASP7663 99%, (E)-2-(7-Fluoro-1-isobutyl-2-oxoindolin-3-ylidene)acetic acid, 99%, 99%, ASP7663, 99.16%. Offered by: GLPBio, TargetMol, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 10mg, 25mg, 5mg, 10mM (in 1ml dmso), 50mg, 100mg, 250mg.
(2E)-2-[7-fluoro-1-(2-methylpropyl)-2-oxoindol-3-ylidene]acetic acid (CAS 1190217-35-6) is a chemical compound with the molecular formula C14H14FNO3 and a molecular weight of 263.26 g/mol. IUPAC name: (2E)-2-[7-fluoro-1-(2-methylpropyl)-2-oxoindol-3-ylidene]acetic acid. InChIKey: RCVZUIGCNAAMIC-UXBLZVDNSA-N.
| Molecular formula | C14H14FNO3 |
|---|---|
| Molecular weight | 263.26 g/mol |
| IUPAC name | (2E)-2-[7-fluoro-1-(2-methylpropyl)-2-oxoindol-3-ylidene]acetic acid |
| InChIKey | RCVZUIGCNAAMIC-UXBLZVDNSA-N |
| SMILES | CC(C)CN1C2=C(C=CC=C2F)/C(=C\C(=O)O)/C1=O |
Computed by PubChem (NCBI)