cas: 20329-98-0 — see every product listed under this CAS number, including other names
(E)-3,4,5-Trimethoxycinnamic acid 98% (CAS 20329-98-0) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A359956-10g |
| cas | 20329-98-0 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10g | 175.69 Pln | |
| Ambeed | 25g | 197.94 Pln | |
| Ambeed | 100g | 381.50 Pln | |
| Ambeed | 500g | 1171.38 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A359956 |
3,4,5-trimethoxycinnamic acid is a methoxycinnamic acid with three methoxy substituents at the 3-, 4- and 5-positions. It has a role as an allergen. It is a conjugate acid of a 3,4,5-trimethoxycinnamate.
Source: ChEBI
| Molecular formula | C12H14O5 |
|---|---|
| Molecular weight | 238.24 g/mol |
| IUPAC name | (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoic acid |
| InChIKey | YTFVRYKNXDADBI-SNAWJCMRSA-N |
| SMILES | COC1=CC(=CC(=C1OC)OC)/C=C/C(=O)O |
Computed by PubChem (NCBI)