CAS 63604-86-4 appears in our catalog under these names: 3'-Acetoxy-2',4'-dimethoxyacetophenone, 95%, 3-Acetoxy-2,4-dimethoxyacetophenone. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 500mg, 1000mg.
(3-acetyl-2,6-dimethoxyphenyl) acetate (CAS 63604-86-4) is a chemical compound with the molecular formula C12H14O5 and a molecular weight of 238.24 g/mol. IUPAC name: (3-acetyl-2,6-dimethoxyphenyl) acetate. InChIKey: DJHZYEIVECLLGP-UHFFFAOYSA-N.
| Molecular formula | C12H14O5 |
|---|---|
| Molecular weight | 238.24 g/mol |
| IUPAC name | (3-acetyl-2,6-dimethoxyphenyl) acetate |
| InChIKey | DJHZYEIVECLLGP-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C(=C(C=C1)OC)OC(=O)C)OC |
Computed by PubChem (NCBI)