CAS 5333-34-6 appears in our catalog under these names: 4-(3,4-Dimethoxyphenyl)-4-oxobutyric acid, 98%, 3-(3,4-Dimethoxybenzoyl)propionic acid, 98% , 4-(3,4-dimethoxyphenyl)-4-oxobutanoic acid, 4-(3,4-Dimethoxyphenyl)-4-oxobutanoic acid, 95%, 95%, 4-(3,4-Dimethoxyphenyl)-4-oxobutyric acid, 95%. Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar), Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 10g, 100mg, 250mg.
4-(3,4-dimethoxyphenyl)-4-oxobutanoic acid (CAS 5333-34-6) is a chemical compound with the molecular formula C12H14O5 and a molecular weight of 238.24 g/mol. IUPAC name: 4-(3,4-dimethoxyphenyl)-4-oxobutanoic acid. InChIKey: BUAYFJKMVBIPKA-UHFFFAOYSA-N.
| Molecular formula | C12H14O5 |
|---|---|
| Molecular weight | 238.24 g/mol |
| IUPAC name | 4-(3,4-dimethoxyphenyl)-4-oxobutanoic acid |
| InChIKey | BUAYFJKMVBIPKA-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(=O)CCC(=O)O)OC |
Computed by PubChem (NCBI)