CAS 309964-23-6 appears in our catalog under these names: 4-(4-Formyl-3-methoxy-phenoxy)-butyric acid, 98%, 4–(4–Formyl–3–methoxyphenoxy)–butyric acid, FMPB-Linker, 4-(4-Formyl-3-methoxyphenoxy)butanoic acid, 98%, 98%, 4-(4'-Formyl-3'-methoxy)phenoxy butyric acid, 96%. Offered by: Combi-blocks, GLPBio, Iris Biotech, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 25g, 1g, 250mg, 50g, 100g.
4-(4-formyl-3-methoxyphenoxy)butanoic acid (CAS 309964-23-6) is a chemical compound with the molecular formula C12H14O5 and a molecular weight of 238.24 g/mol. IUPAC name: 4-(4-formyl-3-methoxyphenoxy)butanoic acid. InChIKey: RHQAFYIBBWZTOI-UHFFFAOYSA-N.
| Molecular formula | C12H14O5 |
|---|---|
| Molecular weight | 238.24 g/mol |
| IUPAC name | 4-(4-formyl-3-methoxyphenoxy)butanoic acid |
| InChIKey | RHQAFYIBBWZTOI-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)OCCCC(=O)O)C=O |
Computed by PubChem (NCBI)