cas: 288617-77-6 — see every product listed under this CAS number, including other names
(R)–2–((((9H–Fluoren–9–yl)methoxy)carbonyl)amino)–2–methylhept–6–enoic acid (CAS 288617-77-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 250mg, 500mg, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GB51362-100 |
| cas | 288617-77-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 100mg | 512.79 Pln | |
| GLPBio | 1g | 919.99 Pln | |
| GLPBio | 250mg | 611.08 Pln | |
| GLPBio | 500mg | 732.77 Pln | |
| GLPBio | 5g | 2193.09 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylhept-6-enoic acid (CAS 288617-77-6) is a chemical compound with the molecular formula C23H25NO4 and a molecular weight of 379.4 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylhept-6-enoic acid. InChIKey: MRJFPZWLOJOINV-HSZRJFAPSA-N.
| Molecular formula | C23H25NO4 |
|---|---|
| Molecular weight | 379.4 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylhept-6-enoic acid |
| InChIKey | MRJFPZWLOJOINV-HSZRJFAPSA-N |
| SMILES | C[C@@](CCCC=C)(C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)