CAS 1217650-00-4 appears in our catalog under these names: Fmoc-trans-4-aminocyclohexane acetic acid, 95%, Fmoc-trans-4-aminocyclohexane acetic acid, 95% (NMR), 2-(trans-4-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)cyclohexyl)acetic acid, 97%, Fmoc-1,4-trans-ACHA-OH, 2-(trans-4-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)cyclohexyl)acetic acid, 95%, 95%. Offered by: Combi-blocks, Ambeed, Iris Biotech, Chemat. Available pack sizes: 5g, 1g, 250mg, 100mg, 25g.
2-[4-(9H-fluoren-9-ylmethoxycarbonylamino)cyclohexyl]acetic acid (CAS 1217650-00-4) is a chemical compound with the molecular formula C23H25NO4 and a molecular weight of 379.4 g/mol. IUPAC name: 2-[4-(9H-fluoren-9-ylmethoxycarbonylamino)cyclohexyl]acetic acid. InChIKey: OAZYEKKFVGYBHJ-UHFFFAOYSA-N.
| Molecular formula | C23H25NO4 |
|---|---|
| Molecular weight | 379.4 g/mol |
| IUPAC name | 2-[4-(9H-fluoren-9-ylmethoxycarbonylamino)cyclohexyl]acetic acid |
| InChIKey | OAZYEKKFVGYBHJ-UHFFFAOYSA-N |
| SMILES | C1CC(CCC1CC(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)