CAS 288617-77-6 appears in our catalog under these names: (R)-N-Fmoc-2-(4'-pentenyl)alanine, 95%, (R)–2–((((9H–Fluoren–9–yl)methoxy)carbonyl)amino)–2–methylhept–6–enoic acid, Fmoc-(R)-2-(pentenyl)Ala-OH 97%, FMOC-(R)-2-(PENTENYL)ALA-OH, >=97% (HPLC, Fmoc-(R)-2-(pentenyl)Ala-OH, 99.43%. Offered by: Combi-blocks, GLPBio, Ambeed, Sigma-Aldrich, MedChemExpress. Available pack sizes: 250mg, 5g, 1g, 100mg, 500mg, 50mg, 25g, 5 g.
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylhept-6-enoic acid (CAS 288617-77-6) is a chemical compound with the molecular formula C23H25NO4 and a molecular weight of 379.4 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylhept-6-enoic acid. InChIKey: MRJFPZWLOJOINV-HSZRJFAPSA-N.
| Molecular formula | C23H25NO4 |
|---|---|
| Molecular weight | 379.4 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylhept-6-enoic acid |
| InChIKey | MRJFPZWLOJOINV-HSZRJFAPSA-N |
| SMILES | C[C@@](CCCC=C)(C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)