CAS 220145-22-2 appears in our catalog under these names: Fmoc-1-aminomethyl-cyclohexane carboxylic acid, 95%, 1-(((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)methyl)cyclohexane-1-carboxylic acid, 95%, Fmoc-1-AMCHC-OH, Fmoc-1-aminomethyl-cyclohexane carboxylic acid 95%, Fmoc-1-aminomethyl-cyclohexane carboxylic acid, 95%, 95%. Offered by: Combi-blocks, AmBeed, Iris Biotech, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 100mg.
1-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]cyclohexane-1-carboxylic acid (CAS 220145-22-2) is a chemical compound with the molecular formula C23H25NO4 and a molecular weight of 379.4 g/mol. IUPAC name: 1-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]cyclohexane-1-carboxylic acid. InChIKey: XCPORARHBOYMBL-UHFFFAOYSA-N.
| Molecular formula | C23H25NO4 |
|---|---|
| Molecular weight | 379.4 g/mol |
| IUPAC name | 1-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]cyclohexane-1-carboxylic acid |
| InChIKey | XCPORARHBOYMBL-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)(CNC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C(=O)O |
Computed by PubChem (NCBI)