Products 1889064-70-3
CAS 1889064-70-3 is the registry number for (S)-2-Methyl-2-((3-(oxiran-2-ylmethoxy)phenyl)sulfonyl)propan-1-ol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-methyl-2-[3-[[(2S)-oxiran-2-yl]methoxy]phenyl]sulfonylpropan-1-ol (CAS 1889064-70-3) is a chemical compound with the molecular formula C13H18O5S and a molecular weight of 286.35 g/mol. IUPAC name: 2-methyl-2-[3-[[(2S)-oxiran-2-yl]methoxy]phenyl]sulfonylpropan-1-ol. InChIKey: VAMPTSRWVXGXTE-LLVKDONJSA-N.
| Molecular formula | C13H18O5S |
|---|---|
| Molecular weight | 286.35 g/mol |
| IUPAC name | 2-methyl-2-[3-[[(2S)-oxiran-2-yl]methoxy]phenyl]sulfonylpropan-1-ol |
| InChIKey | VAMPTSRWVXGXTE-LLVKDONJSA-N |
| SMILES | CC(C)(CO)S(=O)(=O)C1=CC=CC(=C1)OC[C@@H]2CO2 |
Computed by PubChem (NCBI)