CAS 129277-08-3 appears in our catalog under these names: Imidapril Impurity 1, Ethyl (alphaR)-alpha-((Methylsulfonyl)oxy)benzenebutanoate, >95% (GC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 500mg, 50mg.
Ethyl (2R)-2-methylsulfonyloxy-4-phenylbutanoate (CAS 129277-08-3) is a chemical compound with the molecular formula C13H18O5S and a molecular weight of 286.35 g/mol. IUPAC name: ethyl (2R)-2-methylsulfonyloxy-4-phenylbutanoate. InChIKey: QKQLJQXSPKYPFD-GFCCVEGCSA-N.
| Molecular formula | C13H18O5S |
|---|---|
| Molecular weight | 286.35 g/mol |
| IUPAC name | ethyl (2R)-2-methylsulfonyloxy-4-phenylbutanoate |
| InChIKey | QKQLJQXSPKYPFD-GFCCVEGCSA-N |
| SMILES | CCOC(=O)[C@@H](CCC1=CC=CC=C1)OS(=O)(=O)C |
Computed by PubChem (NCBI)