(R)-(4-Bromophenyl)(phenyl)methanamine, 95%
cas: 220441-81-6 — see every product listed under this CAS number, including other names
(R)-(4-Bromophenyl)(phenyl)methanamine, 95% (CAS 220441-81-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 50mg. Offered by: Ambeed, BLDpharm, Fluorochem, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A812113-100mg |
| cas | 220441-81-6 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 414.88 Pln | |
| Ambeed | 250mg | 676.31 Pln | |
| Ambeed | 1g | 1710.94 Pln | |
| BLDpharm | 50mg | 347.68 Pln | |
| BLDpharm | 100mg | 442.09 Pln | |
| BLDpharm | 250mg | 725.32 Pln | |
| BLDpharm | 1g | 1836.04 Pln | |
| Fluorochem | 50mg | 992.38 Pln | |
| Fluorochem | 100mg | 1528.65 Pln | |
| Fluorochem | 250mg | 2465.82 Pln | |
| Chemat | 50mg | 544.40 Pln | |
| Chemat | 100mg | 822.80 Pln | |
| Chemat | 250mg | 1326.80 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
(R)-(4-bromophenyl)-phenylmethanamine (CAS 220441-81-6) is a chemical compound with the molecular formula C13H12BrN and a molecular weight of 262.14 g/mol. IUPAC name: (R)-(4-bromophenyl)-phenylmethanamine. InChIKey: CUGXLVXNFZFUFF-CYBMUJFWSA-N.
| Molecular formula | C13H12BrN |
|---|---|
| Molecular weight | 262.14 g/mol |
| IUPAC name | (R)-(4-bromophenyl)-phenylmethanamine |
| InChIKey | CUGXLVXNFZFUFF-CYBMUJFWSA-N |
| SMILES | C1=CC=C(C=C1)[C@H](C2=CC=C(C=C2)Br)N |
Computed by PubChem (NCBI)