Products 220441-81-6
CAS 220441-81-6 appears in our catalog under these names: (R)–(4–Bromophenyl)(phenyl)methanamine, (R)-(4-Bromophenyl)(phenyl)methanamine 95%, (R)-(4-Bromophenyl)(phenyl)methanamine. Offered by: GLPBio, Ambeed, MedChemExpress. Available pack sizes: 100mg, 25mg, 50mg, 250mg, 1g, 50 mg, 25 mg, 1 g.
(R)-(4-bromophenyl)-phenylmethanamine (CAS 220441-81-6) is a chemical compound with the molecular formula C13H12BrN and a molecular weight of 262.14 g/mol. IUPAC name: (R)-(4-bromophenyl)-phenylmethanamine. InChIKey: CUGXLVXNFZFUFF-CYBMUJFWSA-N.
| Molecular formula | C13H12BrN |
|---|---|
| Molecular weight | 262.14 g/mol |
| IUPAC name | (R)-(4-bromophenyl)-phenylmethanamine |
| InChIKey | CUGXLVXNFZFUFF-CYBMUJFWSA-N |
| SMILES | C1=CC=C(C=C1)[C@H](C2=CC=C(C=C2)Br)N |
Computed by PubChem (NCBI)