cas: 479074-63-0 — see every product listed under this CAS number, including other names
(R)-Ăź-(p-Bromophenyl)alanine, 98% (CAS 479074-63-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F034379-5G |
| cas | 479074-63-0 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 1195.43 Pln | |
| Fluorochem | 10g | 2137.81 Pln | |
| Fluorochem | 100mg | 159.34 Pln | |
| Fluorochem | 250mg | 232.23 Pln | |
| Fluorochem | 1g | 315.53 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(3R)-3-amino-3-(4-bromophenyl)propanoic acid (CAS 479074-63-0) is a chemical compound with the molecular formula C9H10BrNO2 and a molecular weight of 244.08 g/mol. IUPAC name: (3R)-3-amino-3-(4-bromophenyl)propanoic acid. InChIKey: RBOUYDUXPMAYMJ-MRVPVSSYSA-N.
| Molecular formula | C9H10BrNO2 |
|---|---|
| Molecular weight | 244.08 g/mol |
| IUPAC name | (3R)-3-amino-3-(4-bromophenyl)propanoic acid |
| InChIKey | RBOUYDUXPMAYMJ-MRVPVSSYSA-N |
| SMILES | C1=CC(=CC=C1[C@@H](CC(=O)O)N)Br |
Computed by PubChem (NCBI)