cas: 479074-63-0 — see every product listed under this CAS number, including other names
(R)-3-Amino-3-(4-bromophenyl)propanoic acid, 98%, 98% (CAS 479074-63-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I9QE-100mg |
| cas | 479074-63-0 |
| size | 100mg |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 112.40 Pln | |
| Chemat | 250mg | 146.00 Pln | |
| Chemat | 1g | 242.00 Pln | |
| Chemat | 5g | 683.60 Pln | |
| Chemat | 10g | 1163.60 Pln | |
| Chemat | 25g | 2334.80 Pln | |
| Chemat | 50g | 4058.00 Pln | |
| Chemat | 100g | 6818.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(3R)-3-amino-3-(4-bromophenyl)propanoic acid (CAS 479074-63-0) is a chemical compound with the molecular formula C9H10BrNO2 and a molecular weight of 244.08 g/mol. IUPAC name: (3R)-3-amino-3-(4-bromophenyl)propanoic acid. InChIKey: RBOUYDUXPMAYMJ-MRVPVSSYSA-N.
| Molecular formula | C9H10BrNO2 |
|---|---|
| Molecular weight | 244.08 g/mol |
| IUPAC name | (3R)-3-amino-3-(4-bromophenyl)propanoic acid |
| InChIKey | RBOUYDUXPMAYMJ-MRVPVSSYSA-N |
| SMILES | C1=CC(=CC=C1[C@@H](CC(=O)O)N)Br |
Computed by PubChem (NCBI)