Products 2155840-22-3
CAS 2155840-22-3 is the registry number for (2R)-4,4,4-Trifluoro-1-(2,4,5-trifluorophenyl)butan-2-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(2R)-4,4,4-trifluoro-1-(2,4,5-trifluorophenyl)butan-2-amine;hydrochloride (CAS 2155840-22-3) is a chemical compound with the molecular formula C10H10ClF6N and a molecular weight of 293.63 g/mol. IUPAC name: (2R)-4,4,4-trifluoro-1-(2,4,5-trifluorophenyl)butan-2-amine;hydrochloride. InChIKey: CEUHOHFDTFQZRR-FYZOBXCZSA-N.
| Molecular formula | C10H10ClF6N |
|---|---|
| Molecular weight | 293.63 g/mol |
| IUPAC name | (2R)-4,4,4-trifluoro-1-(2,4,5-trifluorophenyl)butan-2-amine;hydrochloride |
| InChIKey | CEUHOHFDTFQZRR-FYZOBXCZSA-N |
| SMILES | C1=C(C(=CC(=C1F)F)F)C[C@H](CC(F)(F)F)N.Cl |
Computed by PubChem (NCBI)