CAS 374822-27-2 appears in our catalog under these names: 1-(3,5-Bis(trifluoromethyl)phenyl)ethanamine Hydrochloride, 95-<97%, 1-(3,5-Bis(trifluoromethyl)phenyl)ethanamine Hydrochloride, ≥97-<99%, 1–(3,5–Bis(trifluoromethyl)phenyl)ethanamine Hydrochloride, 1-[3,5-Bis(trifluoromethyl)phenyl]ethanamine Hydrochloride 95%, 1-(3,5-Bis(trifluoromethyl)phenyl)ethanamine hydrochloride, 98%, 98%. Offered by: Hoffman Fine Chemicals, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 50g, 100g, 200g, 300g, 1g, 250mg.
1-[3,5-bis(trifluoromethyl)phenyl]ethanamine;hydrochloride (CAS 374822-27-2) is a chemical compound with the molecular formula C10H10ClF6N and a molecular weight of 293.63 g/mol. IUPAC name: 1-[3,5-bis(trifluoromethyl)phenyl]ethanamine;hydrochloride. InChIKey: DWSPCWWXKNPRFN-UHFFFAOYSA-N.
| Molecular formula | C10H10ClF6N |
|---|---|
| Molecular weight | 293.63 g/mol |
| IUPAC name | 1-[3,5-bis(trifluoromethyl)phenyl]ethanamine;hydrochloride |
| InChIKey | DWSPCWWXKNPRFN-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)