CAS 1213066-11-5 appears in our catalog under these names: (R)-1-(3-Bromopyridin-2-yl)-2,2,2-trifluoroethan-1-amine, 95%, 95%, (R)-1-(3-BROMOPYRIDIN-2-YL)-2,2,2-TRIFLUOROETHAN-1-AMINE, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
(1R)-1-(3-bromo-2-pyridinyl)-2,2,2-trifluoroethanamine (CAS 1213066-11-5) is a chemical compound with the molecular formula C7H6BrF3N2 and a molecular weight of 255.03 g/mol. IUPAC name: (1R)-1-(3-bromo-2-pyridinyl)-2,2,2-trifluoroethanamine. InChIKey: GCNHEWOOSWFSNT-ZCFIWIBFSA-N.
| Molecular formula | C7H6BrF3N2 |
|---|---|
| Molecular weight | 255.03 g/mol |
| IUPAC name | (1R)-1-(3-bromo-2-pyridinyl)-2,2,2-trifluoroethanamine |
| InChIKey | GCNHEWOOSWFSNT-ZCFIWIBFSA-N |
| SMILES | C1=CC(=C(N=C1)[C@H](C(F)(F)F)N)Br |
Computed by PubChem (NCBI)