Products 1807208-33-8
CAS 1807208-33-8 is the registry number for 1-Bromo-2,3-diamino-6-(trifluoromethyl)benzene, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
3-bromo-4-(trifluoromethyl)benzene-1,2-diamine (CAS 1807208-33-8) is a chemical compound with the molecular formula C7H6BrF3N2 and a molecular weight of 255.03 g/mol. IUPAC name: 3-bromo-4-(trifluoromethyl)benzene-1,2-diamine. InChIKey: JSJALZJBRUAOKB-UHFFFAOYSA-N.
| Molecular formula | C7H6BrF3N2 |
|---|---|
| Molecular weight | 255.03 g/mol |
| IUPAC name | 3-bromo-4-(trifluoromethyl)benzene-1,2-diamine |
| InChIKey | JSJALZJBRUAOKB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(F)(F)F)Br)N)N |
Computed by PubChem (NCBI)