Products 1445995-83-4
CAS 1445995-83-4 appears in our catalog under these names: 4-Bromo-3-(trifluoromethyl)benzene-1,2-diamine, 90%, 1-Bromo-3,4-diamino-2-(trifluoromethyl)benzene, 90%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
4-bromo-3-(trifluoromethyl)benzene-1,2-diamine (CAS 1445995-83-4) is a chemical compound with the molecular formula C7H6BrF3N2 and a molecular weight of 255.03 g/mol. IUPAC name: 4-bromo-3-(trifluoromethyl)benzene-1,2-diamine. InChIKey: SZBGMYJEGZATAG-UHFFFAOYSA-N.
| Molecular formula | C7H6BrF3N2 |
|---|---|
| Molecular weight | 255.03 g/mol |
| IUPAC name | 4-bromo-3-(trifluoromethyl)benzene-1,2-diamine |
| InChIKey | SZBGMYJEGZATAG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1N)N)C(F)(F)F)Br |
Computed by PubChem (NCBI)