Products 2889453-71-6
CAS 2889453-71-6 is the registry number for 2-Bromo-6-(trifluoromethyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-6-(trifluoromethyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole (CAS 2889453-71-6) is a chemical compound with the molecular formula C7H6BrF3N2 and a molecular weight of 255.03 g/mol. IUPAC name: 2-bromo-6-(trifluoromethyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole. InChIKey: BZIGGCOYQZRIDR-UHFFFAOYSA-N.
| Molecular formula | C7H6BrF3N2 |
|---|---|
| Molecular weight | 255.03 g/mol |
| IUPAC name | 2-bromo-6-(trifluoromethyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole |
| InChIKey | BZIGGCOYQZRIDR-UHFFFAOYSA-N |
| SMILES | C1C(CN2C1=NC(=C2)Br)C(F)(F)F |
Computed by PubChem (NCBI)