(R)-1-(3-Fluorophenyl)ethylamine hydrochloride, 97%
cas: 321429-49-6 — see every product listed under this CAS number, including other names
(R)-1-(3-Fluorophenyl)ethylamine hydrochloride, 97% (CAS 321429-49-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg, 5g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A106441-250mg |
| cas | 321429-49-6 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 359.25 Pln | |
| Ambeed | 1g | 1015.62 Pln | |
| Chemat | 100mg | 198.80 Pln | |
| Chemat | 250mg | 266.00 Pln | |
| Chemat | 1g | 755.60 Pln | |
| BLDpharm | 100mg | 308.80 Pln | |
| BLDpharm | 250mg | 386.56 Pln | |
| BLDpharm | 1g | 1091.86 Pln | |
| Fluorochem | 100mg | 289.50 Pln | |
| Fluorochem | 250mg | 362.39 Pln | |
| Fluorochem | 1g | 1049.65 Pln | |
| Fluorochem | 5g | 4038.18 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
(1R)-1-(3-fluorophenyl)ethanamine;hydrochloride (CAS 321429-49-6) is a chemical compound with the molecular formula C8H11ClFN and a molecular weight of 175.63 g/mol. IUPAC name: (1R)-1-(3-fluorophenyl)ethanamine;hydrochloride. InChIKey: RKALWMOKWLLQMU-FYZOBXCZSA-N.
| Molecular formula | C8H11ClFN |
|---|---|
| Molecular weight | 175.63 g/mol |
| IUPAC name | (1R)-1-(3-fluorophenyl)ethanamine;hydrochloride |
| InChIKey | RKALWMOKWLLQMU-FYZOBXCZSA-N |
| SMILES | C[C@H](C1=CC(=CC=C1)F)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
(R)-1-(3-Fluorophenyl)ethylamine hydrochloride, (R)-1-(3-Fluorophenyl)ethylamine HCl, (R)-1-(3-fluorophenyl)ethanamine hydrochloride, (1R)-1-(3-fluorophenyl)ethanamine;hydrochloride, (1R)-1-(3-Fluorophenyl)ethanamine Hydrochloride, (1R)-1-(3-fluorophenyl)ethan-1-amine hydrochloride, (R)-1-(3-FLUOROPHENYL)ETHYLAMINE-HCl, 3-fluoro-a-Methyl-, (R)-1-(3-Fluorophenyl)ethylaminehydrochloride, RKALWMOKWLLQMU-FYZOBXCZSA-N