Products 1193388-08-7

CAS 1193388-08-7 is the registry number for N-Ethyl-3-fluoroaniline hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg, 5g, 250mg.

Structural formula: {0} (CAS {1})

N-ethyl-3-fluoroaniline;hydrochloride (CAS 1193388-08-7) is a chemical compound with the molecular formula C8H11ClFN and a molecular weight of 175.63 g/mol. IUPAC name: N-ethyl-3-fluoroaniline;hydrochloride. InChIKey: FVBSHZOBXDMAFY-UHFFFAOYSA-N.

Identity
Molecular formulaC8H11ClFN
Molecular weight175.63 g/mol
IUPAC nameN-ethyl-3-fluoroaniline;hydrochloride
InChIKeyFVBSHZOBXDMAFY-UHFFFAOYSA-N
SMILESCCNC1=CC(=CC=C1)F.Cl

Computed by PubChem (NCBI)