CAS 1332832-14-0 appears in our catalog under these names: (S)-1-(2-Fluorophenyl)ethylamine hydrochloride, 95%, (S)–1–(2–Fluorophenyl)ethanamine hydrochloride, (S)-1-(2-Fluorophenyl)ethanamine hydrochloride, 97%, 97%, (S)-1-(2-Fluorophenyl)ethanamine hydrochloride, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
(1S)-1-(2-fluorophenyl)ethanamine;hydrochloride (CAS 1332832-14-0) is a chemical compound with the molecular formula C8H11ClFN and a molecular weight of 175.63 g/mol. IUPAC name: (1S)-1-(2-fluorophenyl)ethanamine;hydrochloride. InChIKey: WEZXQPGVPSHAAZ-RGMNGODLSA-N.
| Molecular formula | C8H11ClFN |
|---|---|
| Molecular weight | 175.63 g/mol |
| IUPAC name | (1S)-1-(2-fluorophenyl)ethanamine;hydrochloride |
| InChIKey | WEZXQPGVPSHAAZ-RGMNGODLSA-N |
| SMILES | C[C@@H](C1=CC=CC=C1F)N.Cl |
Computed by PubChem (NCBI)