CAS 1419073-74-7 appears in our catalog under these names: (S)-1-(4-Fluorophenyl)ethylamine hydrochloride, 97%, (S)-1-(4-Fluorophenyl)ethylamine hydrochloride, (S)-1-(4-fluorophenyl)ethan-1-amine hydrochloride, 98%, 98%, (S)-1-(4-Fluorophenyl)ethanamine hydrochloride, 98%, (S)-1-(4-fluorophenyl)ethan-1-amine hydrochloride, 98%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 1g, 10g, 100g, 100mg, 250mg, 25g.
(1S)-1-(4-fluorophenyl)ethanamine;hydrochloride (CAS 1419073-74-7) is a chemical compound with the molecular formula C8H11ClFN and a molecular weight of 175.63 g/mol. IUPAC name: (1S)-1-(4-fluorophenyl)ethanamine;hydrochloride. InChIKey: MBYCTXPTBWSAMJ-RGMNGODLSA-N.
| Molecular formula | C8H11ClFN |
|---|---|
| Molecular weight | 175.63 g/mol |
| IUPAC name | (1S)-1-(4-fluorophenyl)ethanamine;hydrochloride |
| InChIKey | MBYCTXPTBWSAMJ-RGMNGODLSA-N |
| SMILES | C[C@@H](C1=CC=C(C=C1)F)N.Cl |
Computed by PubChem (NCBI)