(R)-1-(4-Bromo-3-fluorophenyl)ethan-1-amine hydrochloride, 95% HPLC
cas: 2708343-89-7 — see every product listed under this CAS number, including other names
(R)-1-(4-Bromo-3-fluorophenyl)ethan-1-amine hydrochloride, 95% HPLC (CAS 2708343-89-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A1538987-100mg |
| cas | 2708343-89-7 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 687.44 Pln | |
| Ambeed | 250mg | 1115.75 Pln | |
| Ambeed | 1g | 2901.31 Pln | |
| BLDpharm | 100mg | 736.43 Pln | |
| BLDpharm | 250mg | 1197.38 Pln | |
| BLDpharm | 1g | 3124.48 Pln | |
| Chemat | 100mg | 669.20 Pln | |
| Chemat | 250mg | 1091.60 Pln | |
| Chemat | 1g | 2834.00 Pln |
properties
| purity | 95% HPLC |
|---|---|
| delivery time | 2-3 weeks |
(1R)-1-(4-bromo-3-fluorophenyl)ethanamine;hydrochloride (CAS 2708343-89-7) is a chemical compound with the molecular formula C8H10BrClFN and a molecular weight of 254.53 g/mol. IUPAC name: (1R)-1-(4-bromo-3-fluorophenyl)ethanamine;hydrochloride. InChIKey: BLXILKBUBMZCET-NUBCRITNSA-N.
| Molecular formula | C8H10BrClFN |
|---|---|
| Molecular weight | 254.53 g/mol |
| IUPAC name | (1R)-1-(4-bromo-3-fluorophenyl)ethanamine;hydrochloride |
| InChIKey | BLXILKBUBMZCET-NUBCRITNSA-N |
| SMILES | C[C@H](C1=CC(=C(C=C1)Br)F)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
(R)-1-(4-Bromo-3-fluorophenyl)ethan-1-amine hydrochloride, (1R)-1-(4-Bromo-3-fluorophenyl)ethan-1-amine HCl, (1R)-1-(4-bromo-3-fluorophenyl)ethanamine;hydrochloride, (R)-1-(4-bromo-3-fluorophenyl)ethanamine hydrochloride, (1R)-1-(4-bromo-3-fluoro-phenyl)ethanamine;hydrochloride, (1R)-1-(4-bromo-3-fluorophenyl)ethan-1-amine hydrochloride