CAS 1624262-55-0 appears in our catalog under these names: (R)-1-(2-Bromo-4-fluorophenyl)ethanamine hydrochloride, 95%, (R)–1–(2–Bromo–4–fluorophenyl)ethanamine hydrochloride, (R)-1-(2-Bromo-4-fluorophenyl)ethanamine hydrochloride, 95%, 95%, (R)-1-(2-BROMO-4-FLUOROPHENYL)ETHANAMINE HCL, 96%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
(1R)-1-(2-bromo-4-fluorophenyl)ethanamine;hydrochloride (CAS 1624262-55-0) is a chemical compound with the molecular formula C8H10BrClFN and a molecular weight of 254.53 g/mol. IUPAC name: (1R)-1-(2-bromo-4-fluorophenyl)ethanamine;hydrochloride. InChIKey: MMBXNJVKDHDORR-NUBCRITNSA-N.
| Molecular formula | C8H10BrClFN |
|---|---|
| Molecular weight | 254.53 g/mol |
| IUPAC name | (1R)-1-(2-bromo-4-fluorophenyl)ethanamine;hydrochloride |
| InChIKey | MMBXNJVKDHDORR-NUBCRITNSA-N |
| SMILES | C[C@H](C1=C(C=C(C=C1)F)Br)N.Cl |
Computed by PubChem (NCBI)