CAS 1311254-85-9 appears in our catalog under these names: (S)-1-(4-Bromo-2-fluorophenyl)ethanamine hydrochloride, 95%, (S)-1-(4-Bromo-2-fluorophenyl)ethanamine hydrochloride, (S)-1-(4-Bromo-2-fluorophenyl)ethanamine hydrochloride 95%, (S)-1-(4-Bromo-2-fluorophenyl)ethanamine hydrochloride, 95%, 95%, (S)-1-(4-BROMO-2-FLUOROPHENYL)ETHANAMINE HCL, 98%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg, 0,5g, 10g.
(1S)-1-(4-bromo-2-fluorophenyl)ethanamine;hydrochloride (CAS 1311254-85-9) is a chemical compound with the molecular formula C8H10BrClFN and a molecular weight of 254.53 g/mol. IUPAC name: (1S)-1-(4-bromo-2-fluorophenyl)ethanamine;hydrochloride. InChIKey: KCVHOOLJEWKAGY-JEDNCBNOSA-N.
| Molecular formula | C8H10BrClFN |
|---|---|
| Molecular weight | 254.53 g/mol |
| IUPAC name | (1S)-1-(4-bromo-2-fluorophenyl)ethanamine;hydrochloride |
| InChIKey | KCVHOOLJEWKAGY-JEDNCBNOSA-N |
| SMILES | C[C@@H](C1=C(C=C(C=C1)Br)F)N.Cl |
Computed by PubChem (NCBI)